\

Pp giải bài tập về anken

Phương pháp giải những dạng bài xích tập chương Hidrocacbon không no

Với cách thức giải các dạng bài bác tập chương Hidrocacbon không no Hoá học lớp 11 tổng hợp các dạng bài xích tập, bài bác tập trắc nghiệm bao gồm lời giải cụ thể với đầy đủ cách thức giải, ví dụ như minh họa để giúp học sinh ôn tập, biết cách làm dạng bài tập chương Hidrocacbon ko no từ kia đạt điểm trên cao trong bài bác thi môn Hoá học tập lớp 11.

Bạn đang xem: Pp giải bài tập về anken

*

Bài tập trắc nghiệm

Bài tập tính chất hóa học của Anken, Ankađien, Ankin

Bài 1: Theo quy tắc cộng Maccopnhicop, propen bội phản ứng cùng với HCl, chiếm được sản phẩm chính là

A. 1-Clpropan B. propan

C. 2-Clopropan D. 1,2-điClopropan.

Hiển thị đáp án

Đáp án: C

Bài 2: chất nào tiếp sau đây làm mất thuốc nước brom?

A. propan B. metan C. propen D. cacbonđioxit

Hiển thị đáp án

Đáp án: C

Anken làm mất màu nước brom do đó người ta sử dụng nước brom hoặc dd brom trong CCl4 làm thuốc thử nhận biết anken

Bài 3: Hiđro hóa hoàn toàn buta-1,3-đien, nhận được

A. butan B. isobutan

C. isopentan D. pentan

Hiển thị đáp án

Đáp án: A

Bài 4: chọn câu trả lời đúng :

A. Anken là số đông hydrocacbon nhưng phân tử có chứa một link đôi C=C

B. Anken là những hydrocacbon cơ mà CTPT có dạng CnH2n, n ≥ 2, nguyên.

C. Anken là phần đa hydrocacbon không no bao gồm CTPT CnH2n, n ≥ 2, nguyên.

D. Anken là đầy đủ hydrocacbon mạch hở mà phân tử gồm chứa một liên kết đôi C=C

Hiển thị đáp án

Đáp án: D

Bài 5: Điều kiện nhằm anken bao gồm đồng phân hình học?

A. mỗi ngtử cacbon ở liên kết đôi liên kết với 1 ngtử hoặc đội ngtử tương đương nhau.

B. từng ngtử cacbon ở link đôi links với 2 ngtử hoặc team ngtử không giống nhau.

C. mỗi ngtử cacbon ở liên kết đôi liên kết với 2 ngtử hoặc đội ngtử tương tự nhau.

D. mỗi ngtử cacbon ở liên kết đôi liên kết với cùng 1 ngtử hoặc team ngtử không giống nhau.

Hiển thị đáp án

Đáp án: B

Bài 6: Áp dụng luật lệ Maccopnhicop vào trường hợp nào sau đây ?

A. phản ứng cùng của Br2 với anken đối xứng.

C. bội nghịch ứng cùng của HX vào anken đối xứng.

B. làm phản ứng trùng vừa lòng của anken.

D. phản nghịch ứng cộng của HX vào anken bất đối xứng.

Hiển thị đáp án

Đáp án: D

Bài 7: Monome của sản phẩm trùng hợp mang tên gọi là polipropilen (P.P) là:

A. (- CH2-CH2-)n B. (-CH2(CH3)-CH-)n

C. CH2 =CH2 D. CH2=CH-CH3

Hiển thị đáp án

Đáp án: D

Bài 8: tóm lại nào sau đó là không đúng ?

A. Ankađien là những HRC không no mạch hở, phân tử có hai link đôi C=C

B. Ankađien có công dụng cộng thích hợp hai phân tử hiđro.

C. số đông hợp chất có công dụng cộng hòa hợp hai phân tử hiđro thuộc một số loại ankađien.

D. phần đa hiđrocacbon ko no mạch hở, phân tử bao gồm hai links đôi phương pháp nhau một links đơn được điện thoại tư vấn là ankađien liên hợp.

Hiển thị đáp án

Đáp án: C

Bài 9: cao su buna là sản phẩm có thành phần chính là polime thu được từ quy trình

A. Trùng vừa lòng butilen, xúc tác natri.

B. Trùng vừa lòng buta –1,3– đien, xúc tác natri.

C. Polime hoá cao su thiên nhiên thiên nhiên.

D. Đồng trùng hợp buta –1,3– đien với natri.

Hiển thị đáp án

Đáp án: B

Bài 10: chất nào không chức năng với dung dịch AgNO3/NH3 ?

A. But-1-in B. But-2-in C. Etin D. Propin

Hiển thị đáp án

Đáp án: B

Akin có nối 3 đầu mạch mới công dụng với dung dịch AgNO3/NH3

Bài 11: Công thức bao quát của Anken là:

A. CnH2n+2(n ≥ 0) B.CnH2n(n ≥ 2)

C. CnH2n (n ≥ 3) D.CnH2n-6(n ≥ 6)

Hiển thị đáp án

Đáp án: B

Bài 12: cho phản ứng thân buta-1,3-đi en với HBr ngơi nghỉ -80°C (tỉ lệ mol 1 : 1), sản phẩm chính của phản ứng là

A. CH3CHBrCH=CH2 B. CH3CH=CHCH2Br

C. CH2BrCH2CH=CH2 D.CH2CH=CBr CH3

Hiển thị đáp án

Đáp án: A

Bài 13: Số links σ trong một phân tử buta-1,2- đien là

A.8 B. 7 C. 6

Hiển thị đáp án

Đáp án: D

Bài 14: Trùng hòa hợp eten, thành phầm thu được có cấu tạo là:

A. (-CH2=CH2-)n . B. (-CH2-CH2-)n.

C. (-CH=CH-)n . D. (-CH3-CH3-)n .

Hiển thị đáp án

Đáp án: B

Bài 15: nhựa P.E(polietilen) được điều chế trực tiếp từ chất nào sau đây?

A. C2H2 B. C2H4 C. C2H6 D. Ý loài kiến khác

Hiển thị đáp án

Đáp án: B

Bài 16: kết luận nào sau đó là đúng?

A. Ankađien gồm công thức phân tử dạng CnH2n–2.

B. các hiđrocacbon có công thức phân tử dạng CnH2n–2 gần như thuộc các loại ankađien.

C. Ankađien không tồn tại đồng phân hình học.

D. Ankađien phân tử khối bự không tác dụng với brom (trong dung dịch).

Hiển thị đáp án

Đáp án: A

Bài 17: cho phản ứng thân buta-1,3-đien và HBr sinh sống -80ºC (tỉ lệ mol 1:1), thành phầm chính của phản bội ứng là

A. CH3CHBrCH=CH2. B. CH3CH=CHCH2Br.

C. CH2BrCH2CH=CH2. D. CH3CH=CBrCH3.

Hiển thị đáp án

Đáp án: A

Bài 18: tóm lại nào sau đấy là không đúng ?

A. Buta–1,3–đien cùng đồng đẳng bao gồm công thức phân tử bình thường CxH2x–2 (x ≥ 3).

B. các hiđrocacbon có công thức phân tử dạng CxH2x–2 cùng với x ≥ 3 số đông thuộc dãy đồng đẳng của ankađien.

C. Buta–1,3–đien là 1 trong ankađien liên hợp.

D. Trùng hòa hợp buta–1,3–đien (có natri làm cho xúc tác) được cao su buna.

Hiển thị đáp án

Đáp án: B

Bài 19: Hidro hóa hoàn toàn axetilen bằng lượng dư hidro gồm xúc tác Ni với đun rét thu được sản phẩm là?

A. Etylen B. etan C. eten D. etyl

Hiển thị đáp án

Đáp án: B

Bài 20: lúc hidro hoá but-2-in bởi lượng H2 dư cùng với xúc tác là Pd/PbCO3 cho sản phẩm chính là:

A. butan B. trans-but-2-en C. Cis-but-2-en D. cả B cùng C

Hiển thị đáp án

Đáp án: D

Dạng bài xích tập Đồng phân, danh pháp của Anken, Ankađien, Ankin

A. Bài bác tập trường đoản cú luận

Bài 1: Viết những đồng phân cấu tạo và call tên anken C5H10.

Hướng dẫn:

Các đồng phân kết cấu anken của C5H10:

CH2=CH-CH2CH2-CH3 (pent-1-en)

CH3CH=CHCH2-CH3 (pent-2-en)

CH2=CH-CH(CH3)-CH3 (3-metylbut-2-en)

CH2=C(CH2)CH2-CH3 (2-metylbut-1-en)

CH3CH=CH(CH3)-CH3 (2-metylbut-2-en)

Bài 2: cho các chất : 2-metylbut-1-en (1); 3,3-đimetylbut-1-en (2); 3-metylpent-1-en (3); 3-metylpent-2-en (4); 3-metylbut-2-en (5). Viết CTCT của những chất. đầy đủ chất như thế nào là đồng phân của nhau ?

Hướng dẫn:

(1) CH2=C(CH2)CH2-CH3

(2) CH2=CH-C(CH3)2-CH3

(3) CH2=CH-CH(CH3)CH2-CH3

(4) CH3CH=C(CH3)CH2-CH3

(5) CH2=CH-CH(CH3)-CH3

Các hóa học là đồng phân của nhau là: (1) cùng (5); (2), (3) cùng (4) .

Bài 3: Viết những đồng phân ankađien liên hợp của C5H8? điện thoại tư vấn tên các đồng phân.

Hướng dẫn:

Các đồng phân liên hợp của C5H8:

CH2=CH-CH=CH-CH3 (penta-1,3-đien)

CH2=C(CH3)-CH=CH2 (2-metylpenta-1,3-đien)

Bài 4: Viết CTCT của những chất sau: (1) Buta-1,3-đien, (2) isopren (3) 2,3-đimetylpenta-1,3-đien.

Hướng dẫn:

(1) CH2=CH-CH=CH2 ;

(2) CH2=C(CH3)-CH=CH2;

(3) CH2=C(CH3)-C(CH3)=CH-CH3

Bài 5: Viết những đồng phân ankin của C4H6 và hotline tên. Cho những đồng phân kia với nước brom dư; hiđro dư (xt thứu tự là Ni) cùng AgNO3 trong dung dịch NH3 viết PTHH xảy ra.

Hướng dẫn:

Các đồng phân ankin của C4H6 là:

CH≡C-CH2-CH3 (but-1-in); CH3-C≡C-CH3 (but-2-in)

Phương trình phản nghịch ứng:

CH≡C-CH2-CH3 + Br2 → CHBr2-CBr2-CH2-CH3

CH≡C-CH2-CH3 + H2 → CH3-CH2-CH2-CH3

CH≡C-CH2-CH3 + AgNO3 + NH3 → CAg≡C-CH2-CH3 + NH4NO3

CH3-C≡C-CH3+ Br2 → CH3-CBr2-CBr2-CH3

CH3-C≡C-CH3 + H2 → CH3-CH2-CH2-CH3

Bài 6: Viết CTCT những ankin mang tên sau: (1) iso-butylaxetilen, (2) metyl iso-propylaxetilen, (3) 3-metylpen-1-in, (4) 2,2,5,5-tetrametylhex-3-in, (5) xicl-clopropylaxetilen.

Hướng dẫn:

(1) (CH3)2-CH-CH2-C≡CH

(2) CH3-C≡C-CH(CH3)2

(3) CH≡C-CH(CH3)-CH2-CH3

(4) CH3-C(CH3)2-C≡C-C(CH3)2-CH3

(5)

*

B. Bài xích tập trắc nghiệm

Bài 1: tên theo danh pháp nước ngoài của chất (CH3)2CHCH=CHCH3 là:

A.1-Metyl-2-isopropyleten B.1,1-Đimetylbut-2-en

C. 1-Isopropylpropen D.4-Metylpent-2-en.

Lời giải:

Đáp án: D

Bài 2: Hợp hóa học C5H10 bao gồm bao nhiêu đồng phân anken ?

A. 4. B. 5. C. 6. D. 7.

Lời giải:

Đáp án: D

5 đồng phân cấu trúc và 2 đồng phân cis – trans

Bài 3: Anken tất cả đồng phân hình học tập ?

A.Pent-1-en. B. Pent-2-en.

C. 2-metylbut-2-en. D. 3-metylbut-1-en.

Lời giải:

Đáp án: B

CTCT: CH3CH=CHCH2-CH3

Bài 4: cho các chất sau:

(1) CH2=CHCH2CH2CH=CH2; (2) CH2=CHCH=CHCH2CH3;

(3) CH3C(CH3)=CHCH2;(4) CH2=CHCH2CH=CH2;

(5) CH3CH2CH=CHCH2CH3;(6) CH3C(CH3)=CH2;

(7) CH3CH2C(CH3)=C(C2H5)CH(CH3)2; (8) CH3CH=CHCH3.

Số chất có đồng phân hình học tập là:

A. 4. B. 1. C. 2. D. 3.

Lời giải:

Đáp án: A

2,5,7,8

Bài 5: Số đồng phân cấu tạo thuộc nhiều loại ankađien ứng với bí quyết phân tử C5H8 là:

A. 4. B. 5. C. 6. D. 7.

Lời giải:

Đáp án: B

Bài 6: Ankađien X có CTCT: CH3-CH=CH-CH(CH3)-CH=CH2. X có tên thay núm là.

A. 4-metylhexa-2,5-đien B. 3-metylhexa-1,4-đien

C. 3-metylhexa-2,4-đien D. A, B, C số đông sai.

Lời giải:

Đáp án: B

Bài 7: Hợp hóa học CH3CH=CHC(CH3)2CH=CH2 có tên thay nuốm là:

A. 4,4-đimetylhexa-2,4-đien B. 3,3-đimetylhexa-1,4-đien

C. 3,4-đimetylhexa-1,4-đien D. 4,5-đimetylhexa-2,4-đien.

Lời giải:

Đáp án: B

Bài 8: Ankađien Z mang tên thay thế: 2,3-đimetylpenta-1,3-đien. Vậy CTCT của Z là

A. CH2=C(CH3)-CH(CH3)-CH=CH2

B. CH2=C(CH3)-C(CH3)=CH-CH3

C. CH2=C=C(CH3)-CH(CH3)-CH2

D. CH2=C(CH3)-CH2-C(CH3)=CH2

Lời giải:

Đáp án: B

Bài 9: C5H8 gồm số đồng phân ankin là:

A. 1 B. 2 C. 3 D. 4

Lời giải:

Đáp án: C

Bài 10: mang đến hợp hóa học hữu cơ tất cả CTCT CH≡C-CH(CH3)2 có tên gọi là:

A. 2-metylbutin B. isopropyl axetilen C. 3-metylbut-1-in D. B hoặc C

Lời giải:

Đáp án: C

Bài 11: Tên thường thì của hòa hợp chất tất cả công thức : CH3 – C ≡ C – CH3 là

A. đimetylaxetilen B. but -3 –in C. but -3 –en D. but-2 –in.

Lời giải:

Đáp án: A

Bài 12: cho công thức cấu trúc của hợp chất sau: CH3-C≡C-CH2-C(Cl)(CH3)-CH3?

Tên gọi đúng theo danh pháp IUPAC của hợp chất trên là:

A. 2 - clo - 2 - metylhex - 4 - in. B. 5 - clo - 5 - metylhex - 2 - in.

C. 2 - metyl - 2 - clohex - 4 - in. D. 5 - metyl - 5 - clohex - 2 - in.

Lời giải:

Đáp án: B

Bài 13: call tên hiđrocacbon có công thức cấu trúc sau:

*

A. 6, 7 - đimetyloct - 4 - in. B. 2 - isopropylhept - 3 - in.

C. 2, 3 - đimetyloct - 4 - in. D. 6 - isopropylhept - 4 -in.

Lời giải:

Đáp án: C

Bài 14: Đimetylaxetilen có tên gọi là

A. propin B. but-1-in C. but-2-in D. but-2-en

Lời giải:

Đáp án: C

Phản ứng cộng của Anken, Ankađien, Ankin

A. Cách thức giải & Ví dụ minh họa

a/ Anken

Lý thuyết và phương pháp giải

*Cộng Br2: CnH2n + Br2 → CnH2nBr2

- Anken : Br2 = 1 : 1 ( tỉ trọng về số mol hoặc thể tích )

- khối lượng của bình tăng thêm là trọng lượng của hidrocabon ko no bị hấp thụ.

- bội phản ứng cùng HX của anken tuân theo luật lệ macopnhicop.

*Cộng H2: CnH2n + H2 → CnH2n + 2

- Tỉ lệ phản ứng luôn là 1:1

- khối lượng trước với sau phản ứng luôn luôn bằng nhau

- Số mol sau phản ứng luôn luôn giảm ( vì mất H2 ) → nH2 pư = nđ - ns

Ví dụ minh họa

Bài 1: Dẫn 3,36 lít hỗn hợp X có 2 anken là đồng đẳng tiếp nối vào bình nước brom dư, thấy cân nặng bình tạo thêm 7,7 gam. Kiếm tìm CTPT của 2 anken ?

Hướng dẫn:

Số mol hỗn hợp X là: nX = 3,36/22,4 = 0,15 mol

Phương trình bội phản ứng:

*

Khối lượng bình brom tăng là cân nặng của 2 anken: mX = 7,7 gam

*

Vậy CTPT của 2 anken tiếp nối là: C3H6 và C4H8

Bài 2: Dẫn thong thả 6,72 lit (đktc) các thành phần hỗn hợp X tất cả etilen với propilen cùng dung dịch brom, hỗn hợp brom bị nhạt màu, và không tồn tại khí bay ra. Trọng lượng dung dịch sau bội nghịch ứng tắng 9,8 gam. Thành phần xác suất theo thể tích của etilen trong X là

Hướng dẫn:

*

Bài 3: cho 4,48 lit hỗn hợp X gồm etan, propan với propen qua dung dịch brom dư, thấy cân nặng bình brom tăng 4,2 gam. Lượng khí còn sót lại thoát ra khỏi dung dịch lấy đốt cháy hoàn toàn thu được 6,48 gam nước. Tính % thể tích những chất bao gồm trong lếu hợp.

Hướng dẫn:

Số mol hỗn hợp X là : nX = 4,48/22,4 = 0,2 mol

Khối lượng bình brom tăng là trọng lượng của propen: mpropen = 4,2 gam ⇒ npropen = 4,2/ 42 = 0,1 mol

Phương trình bội phản ứng: C3H6 + Br2 → C3H6Br2

Khí thoát ra gồm: C2H6 cùng C3H8.

Phương trình phản ứng đốt cháy C2H6 và C3H8

C2H6 + 7/2 O2 −tº→ 2CO2 + 3H2O

C3H8 + 5O2 −tº→ 3CO2 + 4H2O

nH2O = 6,48/18=0,36 mol

Gọi số mol của etan và propan theo thứ tự là x và y mol

Ta cóx + y = 0,2 – 0,1 = 0,1 (1); 3x + 4 y = 0,36 (2)

Từ (1), (2) ⇒ x = 0,04 với y = 0,06.

Phần trăm thể tích mỗi khí trong hỗn hợp lúc đầu là:

%Vetan = 0,04/0,2.100% = 20%; %Vpropan = 0,06/0,2.100% = 30%; %Vpropen = 0,1/0,2.100% = 50%

Bài 4: tất cả hổn hợp khí X bao gồm H2 cùng một anken có tác dụng cộng HBr cho thành phầm hữu cơ duy nhất. Tỉ khối của X so với H2 bằng 9,1. Đun rét X có xúc tác Ni, sau khoản thời gian phản ứng xảy ra hoàn toàn, thu được hỗn hợp khí Y không làm mất đi màu nước brom; tỉ khối của Y đối với H2 bằng 13. Tra cứu công thức cấu tạo của anken.

Hướng dẫn:

Gọi số mol hổn hòa hợp X là 1mol

Ta có Mtb X = 9,1. 2 = 18,2 ⇒ mX = 18,2. 1 = 18,2 g = mY

nhưng mà Mtb Y = 13. 2 = 26 ⇒ nY = 18,2/26= 0,7 mol

⇒ nH2 pư = 1 – 0,7 = 0,3 mol = nanken ⇒ nH2 bđ = 0,7 mol

Manken = (18,2 - 0,7.2)/0,3 = 14n ⇒ n = 4 ⇒ CTPT của anken là C4H8

Bài 5: các thành phần hỗn hợp khí X tất cả H2 với C2H4 bao gồm tỉ khối đối với He là 3,75. Dẫn X qua Ni nung nóng, thu được tất cả hổn hợp khí Y bao gồm tỉ khối so với He là 5. Tính hiệu suất của phản nghịch ứng hiđro hoá?

Hướng dẫn:

Ta có : Mtb X = 4. 3,75 = 15

*

Vậy năng suất tính theo anken hoặc H2 cũng được

Giả sử: nX = 1mol ⇒ mX = 15. 1 = 15 g = mY

Mà Mtb Y = 5. 4 = trăng tròn ⇒ nY = 15/20 = 0,75 mol ⇒ nH2 pư= 1 – 0,75 = 0,25 mol

⇒ H = 0,25/0,5.100% = 50 %

b/ Akadien và Akin

Lý thuyết và phương thức giải

Giả sử X là láo lếu hợp lúc đầu gồm CnH2n-2 và H2; Y là láo lếu hợp những chất sau p/ư

+ những phản ứng xảy ra:

CnH2n-2 + H2 → CnH2n.

CnH2n-2 + 2H2 → CnH2n+2.

+ hỗn hợp Y có thể có: CnH2n, CnH2n+2, CnH2n-2 cùng H2 dư

+ quan hệ nam nữ về khối lượng, ta có: mA = mB

+ quan hệ về số mol, ta có: nA– nB= nH2 bội phản ứng

+ Đốt cháy B cũng là đốt cháy A.

Ví dụ minh họa

Bài 1: cho m gam buta-1,3-đien tính năng vừa hết với (m - 17,5) gam H2 chiếm được a gam thành phầm cộng

a. Tính giá trị của m ?

b. cực hiếm của a là bao nhiêu ?

Hướng dẫn:

CH2=CH-CH=CH2 + 2H2 → CH3-CH2-CH2CH3

a. Số mol buta-1,3-đien: n1 = m/54 mol

Số mol H2 phản bội ứng: nH2 = (m-17,5)/2 mol

Theo phương trình phản nghịch ứng: 2n1 = nH2 ⇔ 2m/54 = (m-17,5)/2 ⇒ m = 18,9 gam

b. quý giá của a là:

a = m + m – 17,5 = 20,3 gam

Bài 2: Một các thành phần hỗn hợp X tất cả 0,12 mol C2H2 cùng 0,18 mol H2. đến X đi qua Ni nung nóng, sau một thời gian thu được các thành phần hỗn hợp khí Y. Cho Y vào bình đựng brom dư, thấy bình brom tăng m gam với thoát ra khí Z. Đốt cháy hết Z với cho toàn thể sản phẩm cháy vào bình đựng hỗn hợp Ca(OH)2 dư thấy bao gồm 5 gam kết tủa mở ra và thấy trọng lượng dung dịch sút 1,36 gam. Tính cực hiếm của m ?

Hướng dẫn:

Khối lượng hỗn hợp X: mX = 0,12.26 + 0,18.2 = 3,48 g

Cho X đi qua Ni nung nóng:

Phương trình phản ứng: C2H2 + H2 → C2H4; C2H2 + 2H2 → C2H6

Hỗn đúng theo Y gồm: C2H2, C2H4, C2H6 cùng H2

Cho Y qua bình đựng Br2 dư gồm C2H2, C2H4 bị giữ lại. Tất cả hổn hợp Z gồm: C2H6 cùng H2

Phương trình bội nghịch ứng: C2H4 + Br2 → C2H4Br2; C2H2 + 2Br2 → C2H2Br4

Đốt cháy Z thu được CO2 với H2O:

nCO2 = nCaCO3 = 0,05 mol.

mdd bớt = m↓ - (mH2O + mCO2) ⇒ mH2O = 5 - 1,36 – 0,05.44 = 1,44 g

Số mol H2O: nH2O = 1,44/18 = 0,08 mol ⇒ mZ = 0,08.2 + 0,05.12 = 0,76 g

Khối lượng bình brom tăng: m = mX - mZ = 3,48 – 0,76 = 2,72 g

Bài 3: tất cả hổn hợp X tất cả 0,15 mol CH4; 0,09 mol C2H2 cùng 0,2 mol H2. Nung lạnh X cùng với xúc tác Ni thu được tất cả hổn hợp Y. Mang lại Y qua hỗn hợp brom dư thu được hỗn hợp khí Z (có tỉ khối so với He là 4). Biết bình brom tăng 0,82 gam. Tính % thể tích của C2H6 trong hỗn hợp Z.

Hướng dẫn:

Nung nóng X cùng với Ni thu được hỗn hợp Y gồm: C2H2, C2H4, C2H6, CH4, H2

Cho Y qua bình brom: C2H2, C2H4 bị duy trì lại. Tất cả hổn hợp khí Z: C2H6, CH4, H2

Phương trình làm phản ứng: C2H4 + Br2 → C2H4Br2; C2H2 + 2Br2 → C2H2Br4

Khối lượng của hỗn hợp X: mX = 0,15.16 + 0,09.26 + 0,2.2 = 5,14 g

Khối lượng của hỗn hợp Z : mZ = 5,14 – 0,82 = 4,32 g ⇒ nZ = 4,32/16 = 0,27 mol

nH2+C2H6 = 0,27 – 0,15 = 0,12 mol

Gọi số mol của H2 và C2H6 thứu tự là: x cùng y ta có: x + y = 0,12 mol

2x + 30 y + 16.0,15 = 4,32 ⇒ x + 15 y = 0,96 ⇒ x = 0,06 với y = 0,06

% thể tích của C2H6 trong tất cả hổn hợp Z: %VC2H6 = 0,06.100%/0,27 = 22,22%

B. Bài bác tập trắc nghiệm

Bài 1: Dẫn 0,2 mol một olefin A qua hỗn hợp brom dư, trọng lượng bình sau phản bội ứng tăng 5,6 gam.Vậy cách làm phân tử của A là:

A. C2H4 B. C3H6 C. C4H8 D. C5H10

Lời giải:

Đáp án: A

*

MX = 5,6/0,2 = 28 ⇒ n = 2

Bài 2: mang đến V lít một anken A nghỉ ngơi đkc qua lọ nước brom dư, tất cả 8 g Br2 sẽ phản ứng đồng thời khối lượng bình tăng 2,8g. Còn mặt khác khi mang lại A phản nghịch ứng cùng với HBr chỉ thu được 1 mặt hàng . Giá trị của V và tên của A là:

A. 2,24 lít; propen B. 2,24 lít; etilen

C. 1,12 lít; but-1-en D. 1,12 lít; but-2-en

Lời giải:

Đáp án: D

CTPT A : CnH2n ; na = nBr2 = 8/160 = 0,05 mol; MA = 2,8/0,05 = 56 ⇒ n = 4;

A bội nghịch ứng Br2 mang lại 1sản phẩm ⇒ A có kết cấu đối xứng.

Bài 3: Một các thành phần hỗn hợp X có thể tích 11,2 lít (đktc), X tất cả 2 anken đồng đẳng tiếp đến nhau. Khi mang lại X qua nước Br2 dư thấy cân nặng bình Br2 tăng 15,4g. Xác minh CTPT cùng số mol mỗi anken trong tất cả hổn hợp X.

A. 0,2 mol C2H4 cùng 0,3 mol C3H6 B. 0,2 mol C3H6 cùng 0,2 mol C4H8

C. 0,4 mol C2H4 cùng 0,1 mol C3H6 D. 0,3 mol C2H4 cùng 0,2 mol C3H6

Lời giải:

Đáp án: C

*

nX = 11,2/ 22,4 = 0,5 mol; mX = 15,4 gam

Mtb X = mX/nX = 15,4/0,5 = 30,8 ⇒ ntb = 2,2. 2

⇒ anken là: C2H4 cùng C3H6; nC2H4 : nC3H6 = 4:1

⇒ nC2H4 = 0,4 mol và nC3H6 = 0,1 mol

Bài 4: cho 10g hỗn hợp khí X tất cả etilen và etan qua hỗn hợp Br2 25% tất cả 160g dd Br2 bội phản ứng. % khối lượng của etilen trong tất cả hổn hợp là:

A. 70% B. 30% C. 35,5% D. 64,5%

Lời giải:

Đáp án: A

nC2H4 = nBr2 = 25.160/100.160 = 0,25 mol ⇒ %mC2H4 = 0,25.28/10.100% = 70%

Bài 5: lúc cho tất cả hổn hợp A có anken với H2 trải qua xúc tác Ni nung rét thu được hỗn hợp B. Điều xác minh nào sau đó là đúng?

A. na B B. na – nB = nH2 pư C. MA = MB D. mA > mB

Lời giải:

Đáp án: B

Bài 6: các thành phần hỗn hợp khí X bao gồm 0,3 mol H2 cùng 0,1 mol propen. Nung X một thời hạn với xúc tác Ni thu được các thành phần hỗn hợp khí Y tất cả tỉ khối so với H2 là 16. Tính số mol H2 phản bội ứng?

A. 0,15 mol B. 0,2 mol C. 0,25 mol D. 0,3 mol

Lời giải:

Đáp án: C

mX = 0,3.2 + 0,1.42 = 4,8 g ⇒ nY = 4,8/32 = 0,15 mol; nH2 pư = 0,4 – 0,15 = 0,25 mol

Bài 7: tất cả hổn hợp X bao gồm H2, C2H4 với C3H6 bao gồm tỉ khối so với H2 là 9,25. Mang lại 22,4 lít X (đktc) vào bình kín có sẵn một ít bột Ni. Đun lạnh bình một thời gian, thu được tất cả hổn hợp khí Y có tỉ khối đối với H2 bởi 10. Tổng cộng mol H2 sẽ phản ứng là

A. 0,070 mol B. 0,015 mol

C. 0,075 mol D. 0,050 mol

Lời giải:

Đáp án: C

mX = 18,5.1 = 18,5 g; nY = 18,5/20 = 0,925 mol ⇒ nH2 pư = 1 – 0,925 = 0,075 mol

Bài 8: tất cả hổn hợp khí X gồm hiđro với một anken. Nung lạnh 24,64 lít tất cả hổn hợp X (đktc), có Ni làm cho xúc tác. Sau bội phản ứng chiếm được 25,3 gam tất cả hổn hợp khí Y. Tỷ khối của X so với H2 là:

A. 10,5 gam B. 11,5 gam C. 12 gam D. 12,5 gam

Lời giải:

Đáp án: B

nX = 26,64/22,4 = 1,1 mol; MX.nX = mX = mY ⇒ MX = 25,3/1,1 = 23; dX/H2 = 23/2 = 11,5

Bài 9: hỗn hợp khí A đựng eilen và H2. Tỉ khối của A đối với hiđro là 7,5. Dẫn A đi qua chất xuc tác Ni nung nóng thu được hh khí B tất cả tỉ khối so với hiđro là 9,0. Năng suất phản ứng cộng hiđro của etilen là:

A. 33,3% B. 66,7% C. 25% D. 50%

Lời giải:

Đáp án: A

Mtb A = 2. 7,5 = 15

trả sử mãng cầu = 1mol ⇒ mB = mA = 15. 1 = 15 g ; nC2H4 : nH2 = 1:1

mà lại Mtb B = 9. 2 = 18 ⇒ nB = 0,83 mol ⇒ nH2 pư = 1 – 0,83 = 0,167 mol

⇒ H = 0,176/0,5 .100% = 33,3%

Bài 10: Đun nóng 20,16 lít tất cả hổn hợp khí X gồm C2H4 với H2 sử dụng Ni xúc tác thì nhận được 13,44 lít hỗn hợp khí Y. đến Y lội thật chậm rì rì qua bình đựng dung dịch Br2 dư thì thấy trọng lượng bình tăng 2,8 gam. Năng suất phản ứng hidro hóa anken:

A. 40% B. 60% C. 65% D. 75%

Lời giải:

Đáp án: D

nX = 20,16/22,4 = 0,9 mol; nY = 13,44/22,4 = 0,6 mol; nH2 pư = 0,9 – 0,6 = 0,3 mol; nanken dư = 2,8/28 = 0,1 mol; nanken bđ = 0,1 + 0,3 = 0,4 mol ⇒ nH2 bđ = 0,5 mol ⇒ H = 0,3/0,4.100%=75%

Bài 11: mang đến H2 với 1 olefin rất có thể tích đều bằng nhau qua Niken đun nóng ta được hỗn hợp A. Biết tỉ khối khá của A đối với H2 là 23,2. Năng suất phản ứng hiđro hoá là 75%. Công thức phân tử olefin là

A. C2H4. B. C3H6. C. C4H8. D. C5H10.

Lời giải:

Đáp án: C

đưa sử nanken = nH2 = 1 mol; mãng cầu = 2- 0,75 = 1,25 mol; Mđ = 23,2.2.1,25/2 = 14,5; 14.n + 2 = 2.14,5 ⇒ n = 4

Bài 12: 2,24 lít hỗn hợp X gồm buta–1,3–đien với penta–1–3-đien (đktc) tất cả thể công dụng hết về tối đa bao nhiêu lít hỗn hợp brom 0,10 M ?

A. 2l B. 3l C.2,5l D.4l

Lời giải:

Đáp án: A

nBr2 = 2nX = 0,2 mol ⇒ VBr2 = 0,2/0,1 = 2 lít

Bài 13: chất nào tiếp sau đây không yêu cầu là sản phẩm cộng giữa hỗn hợp brom cùng isopren (theo tỉ lệ thành phần mol 1:1) ?

A. CH2BrC(CH3)BrCH=CH2. B. CH2BrC(CH3)=CHCH2Br.

C. CH2BrCH=CHCH2CH2Br. D. CH2=C(CH3)CHBrCH2Br.

Lời giải:

Đáp án: C

Bài 14: Ankađien A + brom (dd) CH3C(CH3)BrCH=CHCH2Br. Vậy A là

A. 2-metylpenta-1,3-đien. B. 2-metylpenta-2,4-đien.

C. 4-metylpenta-1,3-đien. D. 2-metylbuta-1,3-đien.

Lời giải:

Đáp án: C

Bài 15: mang lại but-1-in bội nghịch ứng cùng với H2 (theo tỉ lệ mol 1:1 cùng xúc tác Pd/PbCO3) thu được sản phẩm hữu cơ mang tên là:

A. Butan B. But-2-en C. But-1-en D. A cùng C hầu hết đúng.

Lời giải:

Đáp án: C

Bài 16: cho các chất cơ học :

CH2=CH–CH2–CH3 (M)

CH≡C–CH2–CH3 (N)

CH2=C=CH–CH3 (P)

CH2=CH–CH=CH2 (Q)

CH2=C(CH3)–CH3 (R)

Những chất cho cùng 1 sản phẩm cộng hiđro là:

A. M, N, P, Q B. M, N, R C. M, N, R D. Q, R

Lời giải:

Đáp án: A

Bài 17: cho m gam propin công dụng với H2 dư (Ni, tº) nhận được (m + 8) gam thành phầm hữu cơ Y. Cực hiếm của m là:

A. 80 gam. B. 40 gam C. 160 gam D. 120 gam

Lời giải:

Đáp án: A

Bài 18: mang đến 3,12 gam ankin X phản bội ứng với 0,1 mol H2 (xúc tác Pd/PbCO3, tº), thu được hỗn hợp Y chỉ gồm hai hiđrocacbon. Bí quyết phân tử của X là

A. C2H2. B. C5H8. C. C4H6. D. C3H4.

Lời giải:

Đáp án: A

nankin > 0,1 mol; MX 2H2

Bài 19: tất cả hổn hợp X có C2H2 và H2 bao gồm cùng số mol. Rước một lượng các thành phần hỗn hợp X cho qua hóa học xúc tác nung nóng, thu được hỗn hợp Y có C2H4, C2H6, C2H2 cùng H2. Sục Y vào dung dịch brom (dư) thì cân nặng bình brom tăng 10,8 gam cùng thoát ra 4,48 lít hỗn hợp khí (đktc) bao gồm tỉ khối so với H2 là 8. Thể tích O2(đktc) cần để đốt cháy hoàn toàn hỗn đúng theo Y là:

A. 33,6 lít. B. 22,4 lít. C. 44,8 lít. D. 26,88 lít.

Lời giải:

Đáp án: A

mX = 10,8 + 16.0,2 = 14 g

mX = mC2H2 + mH2 = 26x + 2x = 28x = 14 ⇒ x = 0,5 mol;

nO2 = 0,5nH2 + 2,5nC2H2 = 0,5 + 2,5.0,5 = 1,5 mol ⇒ V = 33,6 lít

Bài 20: Đun nóng hỗn hợp khí bao gồm 0,06 mol C2H2 và 0,04 mol H2 với xúc tác Ni, sau một thời gian thu được hỗn hợp khí Y. Dẫn toàn cục hỗn hợp Y lội rảnh qua bình đựng hỗn hợp brom (dư) thì còn lại 0,448 lít hỗn hợp khí Z (ở đktc) bao gồm tỉ khối đối với O2 là 0,5. Khối lượng bình hỗn hợp brom tăng là:

A. 1,04 gam. B. 1,64 gam. C.

Xem thêm: Dem Trang - Lời Bài Hát Đêm Trắng (Nhạc Chuông)

1,20 gam. D. 1,32 gam

Lời giải:

Đáp án: D

mY = 0,06.26 + 0,04.2 = 1,64 g; mZ = 0,02.16 = 0,32 g; m↑ = mY – mZ = 1,64 – 0,32 = 1,32